EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:173420 - L-trans-alpha-Amino-2-carboxycyclopropaneacetic acid
| Formula | C6H9NO4 |
| Net Charge | 0 |
| Average Mass | 159.141 |
| Monoisotopic Mass | 159.05316 |
| SMILES | NC(C(=O)O)C1CC1C(=O)O |
| InChI | InChI=1S/C6H9NO4/c7-4(6(10)11)2-1-3(2)5(8)9/h2-4H,1,7H2,(H,8,9)(H,10,11) |
| InChIKey | GZOVEPYOCJWRFC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-trans-alpha-Amino-2-carboxycyclopropaneacetic acid (CHEBI:173420) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-[amino(carboxy)methyl]cyclopropane-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034442 | HMDB |
| 1233 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:22255-17-0 | ChemIDplus |