EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10S |
| Net Charge | 0 |
| Average Mass | 114.213 |
| Monoisotopic Mass | 114.05032 |
| SMILES | [H]C(C)=C([H])SC([H])=C([H])C |
| InChI | InChI=1S/C6H10S/c1-3-5-7-6-4-2/h3-6H,1-2H3 |
| InChIKey | RJDJXOBGMMKPMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium sativum (ncbitaxon:4682) | |||
| - | PubMed (32010343) | ||
| - | PubMed (27056828) | ||
| Allium cepa (ncbitaxon:4679) | - | PubMed (27056828) | |
| Allium tuberosum (ncbitaxon:4683) | - | PubMed (25470273) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| di-1-propenyl sulfide (CHEBI:173382) has role flavouring agent (CHEBI:35617) |
| di-1-propenyl sulfide (CHEBI:173382) has role volatile oil component (CHEBI:27311) |
| di-1-propenyl sulfide (CHEBI:173382) is a olefinic compound (CHEBI:78840) |
| di-1-propenyl sulfide (CHEBI:173382) is a organic sulfide (CHEBI:16385) |
| Incoming Relation(s) |
| (E,E)-di-1-propenyl sulfide (CHEBI:180540) is a di-1-propenyl sulfide (CHEBI:173382) |
| (E,Z)-di-1-propenyl sulfide (CHEBI:180542) is a di-1-propenyl sulfide (CHEBI:173382) |
| (Z,Z)-di-1-propenyl sulfide (CHEBI:180541) is a di-1-propenyl sulfide (CHEBI:173382) |
| IUPAC Name |
|---|
| 1-(prop-1-en-1-ylsulfanyl)prop-1-ene |
| Synonyms | Source |
|---|---|
| propenyl sulfide | ChEBI |
| dipropenyl sulfide | ChEBI |
| di-1-propenyl sulfide | ChEBI |
| bis(1-propenyl) sulfide | ChEBI |
| 1,1'-thiobis[1-propene] | ChEBI |
| 1-[1-propenylsulfanyl]-1-propene | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040234 | HMDB |
| 20481479 | ChemSpider |
| FDB019949 | FooDB |
| C00058090 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1736689 | Reaxys |
| CAS:33922-80-4 | ChemIDplus |
| CAS:33922-80-4 | NIST Chemistry WebBook |
| Citations |
|---|