EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O3 |
| Net Charge | 0 |
| Average Mass | 303.362 |
| Monoisotopic Mass | 303.15829 |
| SMILES | N[C@@H](CCCCNC(=O)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H21N3O3/c17-13(16(21)22)6-3-4-8-18-15(20)9-11-10-19-14-7-2-1-5-12(11)14/h1-2,5,7,10,13,19H,3-4,6,8-9,17H2,(H,18,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | FKIGOUKDKBOZID-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-[(indol-3-yl)acetyl]-L-lysine (CHEBI:17328) is a N6-acyl-L-lysine (CHEBI:16232) |
| N6-[(indol-3-yl)acetyl]-L-lysine (CHEBI:17328) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| N6-[(indol-3-yl)acetyl]-L-lysine (CHEBI:17328) is tautomer of N6-[(indol-3-yl)acetyl]-L-lysine zwitterion (CHEBI:58105) |
| Incoming Relation(s) |
| N6-[(indol-3-yl)acetyl]-L-lysine zwitterion (CHEBI:58105) is tautomer of N6-[(indol-3-yl)acetyl]-L-lysine (CHEBI:17328) |
| IUPAC Names |
|---|
| (2S)-2-amino-6-(1H-indol-3-ylacetamido)hexanoic acid |
| N6-(1H-indol-3-ylacetyl)-L-lysine |
| Synonyms | Source |
|---|---|
| N6-[(Indol-3-yl)acetyl]-L-lysine | KEGG COMPOUND |
| N6-[(Indole-3-yl)acetyl]-L-lysine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04211 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6153789 | Beilstein |