EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O2 |
| Net Charge | 0 |
| Average Mass | 414.674 |
| Monoisotopic Mass | 414.34978 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@H](C)C[C@H](O)C1=C |
| InChI | InChI=1S/C28H46O2/c1-19-17-23(21(3)26(29)18-19)12-11-22-10-8-16-28(6)24(13-14-25(22)28)20(2)9-7-15-27(4,5)30/h11-12,19-20,24-26,29-30H,3,7-10,13-18H2,1-2,4-6H3/b22-11+,23-12-/t19-,20+,24+,25-,26-,28+/m0/s1 |
| InChIKey | CFTBOPSKSDQDCX-RBYOMADFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,25-dihydroxy-3alpha-methyl-3-deoxyvitamin D3 /1alpha,25-dihydroxy-3alpha-methyl-3-deoxycholecalciferol (CHEBI:173228) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3Z,5S)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-methyl-2-methylidenecyclohexan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| LMST03020336 | LIPID MAPS |
| 4446864 | ChemSpider |