EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O4 |
| Net Charge | 0 |
| Average Mass | 474.726 |
| Monoisotopic Mass | 474.37091 |
| SMILES | CC(O)(CO)C1CCC(C)(C2CCC3(C)C2CCC2C4(C)CCC(=O)C(C)(C)C4CCC23C)O1 |
| InChI | InChI=1S/C30H50O4/c1-25(2)21-11-16-28(5)22(26(21,3)14-12-23(25)32)9-8-19-20(10-15-27(19,28)4)30(7)17-13-24(34-30)29(6,33)18-31/h19-22,24,31,33H,8-18H2,1-7H3 |
| InChIKey | LBWOQWCMNAJNNC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20,24-Epoxy-25,26-dihydroxydammaran-3-one (CHEBI:173206) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| 17-[5-(1,2-dihydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039692 | HMDB |