EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)C(=O)C[C@@]21[H] |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3,12-15,17,20,22H,4-10H2,1-2H3/t12-,13+,14-,15-,17-,18-,19-/m0/s1 |
| InChIKey | AKRBLZKRYPEVIK-PEMPUTJUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-Oxoandrostenediol (CHEBI:173191) has role androgen (CHEBI:50113) |
| 16-Oxoandrostenediol (CHEBI:173191) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| Manual Xrefs | Databases |
|---|---|
| 132993 | ChemSpider |
| LMST02020088 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:1159-66-6 | ChemIDplus |