EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O3 |
| Net Charge | 0 |
| Average Mass | 278.392 |
| Monoisotopic Mass | 278.18819 |
| SMILES | CCCCCC(=O)/C=C\C=C\C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C17H26O3/c1-2-3-10-13-16(18)14-11-8-6-4-5-7-9-12-15-17(19)20/h5-8,11,14H,2-4,9-10,12-13,15H2,1H3,(H,19,20)/b7-5+,8-6+,14-11- |
| InChIKey | BEHRKNVAYQNKGG-XTYDYNBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-5E,8E,10Z-heptadecatrienoic acid (CHEBI:173189) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (5E,8E,10Z)-12-oxoheptadeca-5,8,10-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060111 | LIPID MAPS |
| 4472329 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:103374-38-5 | ChemIDplus |