EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COC(=O)C(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-9)7-10(12)11(13)15-2/h3-6H,7H2,1-2H3 |
| InChIKey | YFKAHHRRSJDIOX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 3-(4-methoxyphenyl)-2-oxopropanoate (CHEBI:173183) has functional parent pyruvic acid (CHEBI:32816) |
| Methyl 3-(4-methoxyphenyl)-2-oxopropanoate (CHEBI:173183) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| methyl 3-(4-methoxyphenyl)-2-oxopropanoate |
| Manual Xrefs | Databases |
|---|---|
| 80455 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:22027-50-5 | ChemIDplus |