EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O4 |
| Net Charge | 0 |
| Average Mass | 418.618 |
| Monoisotopic Mass | 418.30831 |
| SMILES | [H][C@]1([C@@](C)(O)CCC(C)(C)O)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12C |
| InChI | InChI=1S/C26H42O4/c1-17-19(15-20(27)16-22(17)28)9-8-18-7-6-12-25(4)21(18)10-11-23(25)26(5,30)14-13-24(2,3)29/h8-9,20-23,27-30H,1,6-7,10-16H2,2-5H3/b18-8+,19-9-/t20-,21+,22+,23+,25+,26+/m1/s1 |
| InChIKey | LZTXMVHOUSVQPL-XLDAUDPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S)-1alpha,20,25-trihydroxy-24-norvitamin D3/(20S)-1alpha,20,25-trihydroxy-24-norcholecalciferol (CHEBI:173181) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3S,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(2S)-2,5-dihydroxy-5-methylhexan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826256 | ChemSpider |
| LMST03020064 | LIPID MAPS |