EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O4 |
| Net Charge | 0 |
| Average Mass | 388.548 |
| Monoisotopic Mass | 388.26136 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C24H36O4/c1-15(6-11-23(27)28)20-9-10-21-17(5-4-12-24(20,21)3)7-8-18-13-19(25)14-22(26)16(18)2/h7-8,15,19-22,25-26H,2,4-6,9-14H2,1,3H3,(H,27,28)/b17-7+,18-8-/t15-,19-,20-,21+,22+,24-/m1/s1 |
| InChIKey | OOUYRLBHGAIYSC-JIOPYBTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha-Hydroxy-25,26,27-trinorvitamin D3 24-carboxylic acid (CHEBI:173161) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (4R)-4-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7826222 | ChemSpider |
| LMST03020022 | LIPID MAPS |