EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO11S2 |
| Net Charge | 0 |
| Average Mass | 339.300 |
| Monoisotopic Mass | 338.99300 |
| SMILES | [H]C(=O)[C@H](NS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)O |
| InChI | InChI=1S/C6H13NO11S2/c8-1-3(7-19(12,13)14)5(10)6(11)4(9)2-18-20(15,16)17/h1,3-7,9-11H,2H2,(H,12,13,14)(H,15,16,17)/t3-,4+,5+,6+/m0/s1 |
| InChIKey | BQSMUQUKNCGJCT-SLPGGIOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-N,6-O-disulfo-D-glucosamine (CHEBI:17316) is a N-sulfoglucosamine (CHEBI:21794) |
| 2-N,6-O-disulfo-D-glucosamine (CHEBI:17316) is a glucosamine sulfate (CHEBI:37878) |
| 2-N,6-O-disulfo-D-glucosamine (CHEBI:17316) is conjugate acid of 2-N,6-O-disulfonato-D-glucosamine(2−) (CHEBI:58102) |
| Incoming Relation(s) |
| 2-N,6-O-disulfonato-D-glucosamine(2−) (CHEBI:58102) is conjugate base of 2-N,6-O-disulfo-D-glucosamine (CHEBI:17316) |
| IUPAC Names |
|---|
| 2-deoxy-6-O-sulfo-2-sulfoamino-D-glucose |
| 2-N-sulfo-6-O-sulfo-D-glucosamine |
| 2-deoxy-2-sulfoamino-D-glucose 6-(hydrogen sulfate) |
| Synonyms | Source |
|---|---|
| N,6-O-Disulfo-D-glucosamine | KEGG COMPOUND |
| N2,6-Disulfo-D-glucosamine | KEGG COMPOUND |