EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | O=C(O)CCCCCCCCCCCCC1CCCC1 |
| InChI | InChI=1S/C18H34O2/c19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h17H,1-16H2,(H,19,20) |
| InChIKey | GPWJVXHWELIFNF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclopentanetridecanoic acid (CHEBI:173132) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 13-cyclopentyltridecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 11531274 | ChemSpider |
| LMFA01140041 | LIPID MAPS |