EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O9 |
| Net Charge | 0 |
| Average Mass | 430.409 |
| Monoisotopic Mass | 430.12638 |
| SMILES | C=CCc1ccc(OC(=O)c2ccccc2)c(OC2OC(C(=O)O)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C22H22O9/c1-2-6-12-9-10-14(29-21(28)13-7-4-3-5-8-13)15(11-12)30-22-18(25)16(23)17(24)19(31-22)20(26)27/h2-5,7-11,16-19,22-25H,1,6H2,(H,26,27) |
| InChIKey | RNHPWASTISTGIP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | feces (BTO:0000440) | MetaboLights (MTBLS2721) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[2-(benzoyloxy)-5-(prop-2-en-1-yl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:173128) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-(2-benzoyloxy-5-prop-2-enylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |