EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC=C(C)C=C1C(C)(C)CCC[C@H]2C |
| InChI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h7,10,12-13H,5-6,8-9H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | JMGZKUMTFGHNRS-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epitrix fuscula (ncbitaxon:226608) | - | PubMed (17075723) | |
| Phyllotreta cruciferae (ncbitaxon:224133) | - | PubMed (16273436) | |
| Phyllotreta striolata (ncbitaxon:444603) | - | PubMed (27518387) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6R,7S)-himachala-9,11-diene (CHEBI:173120) has role animal metabolite (CHEBI:75767) |
| (6R,7S)-himachala-9,11-diene (CHEBI:173120) has role pheromone (CHEBI:26013) |
| (6R,7S)-himachala-9,11-diene (CHEBI:173120) is a carbobicyclic compound (CHEBI:36785) |
| (6R,7S)-himachala-9,11-diene (CHEBI:173120) is a sesquiterpene (CHEBI:35189) |
| (6R,7S)-himachala-9,11-diene (CHEBI:173120) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| (9R,9aS)-3,5,5,9-tetramethyl-5,6,7,8,9,9a-hexahydro-1H-benzo[7]annulene |
| Synonyms | Source |
|---|---|
| (+)-(6R,7S)-himachala-9,11-diene | ChEBI |
| (6R,7S)-(+)-himachala-9,11-diene | ChEBI |
| UniProt Name | Source |
|---|---|
| (6R,7S)-himachala-9,11-diene | UniProt |
| Citations |
|---|