EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClN2O5 |
| Net Charge | 0 |
| Average Mass | 442.899 |
| Monoisotopic Mass | 442.12955 |
| SMILES | [H][C@]1(c2ccc(C(=O)OC)cc2)C2Nc3ccccc3C2C[C@H](C(=O)OC)N1C(=O)CCl |
| InChI | InChI=1S/C23H23ClN2O5/c1-30-22(28)14-9-7-13(8-10-14)21-20-16(15-5-3-4-6-17(15)25-20)11-18(23(29)31-2)26(21)19(27)12-24/h3-10,16,18,20-21,25H,11-12H2,1-2H3/t16?,18-,20?,21+/m1/s1 |
| InChIKey | CKRZDIUOUCGSBK-YBKKDXPLSA-N |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.11.1.9 (glutathione peroxidase) inhibitor An inhibitor of peroxidases (EC 1.11.1.*) that inhibits the action of glutathione peroxidase (EC 1.11.1.9). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RSL3 (CHEBI:173109) has role antineoplastic agent (CHEBI:35610) |
| RSL3 (CHEBI:173109) has role EC 1.11.1.9 (glutathione peroxidase) inhibitor (CHEBI:176342) |
| RSL3 (CHEBI:173109) has role ferroptosis inducer (CHEBI:173085) |
| RSL3 (CHEBI:173109) is a benzoate ester (CHEBI:36054) |
| RSL3 (CHEBI:173109) is a diester (CHEBI:51307) |
| RSL3 (CHEBI:173109) is a methyl ester (CHEBI:25248) |
| RSL3 (CHEBI:173109) is a organochlorine compound (CHEBI:36683) |
| RSL3 (CHEBI:173109) is a tertiary carboxamide (CHEBI:140326) |
| RSL3 (CHEBI:173109) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| methyl (1S,3R)-2-(chloroacetyl)-1-[4-(methoxycarbonyl)phenyl]-2,3,4,4a,9,9a-hexahydro-1H-β-carboline-3-carboxylate |
| Synonyms | Source |
|---|---|
| (1S,3R)-RSL3 | ChEBI |
| ras-selective lethal small molecule 3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C21479 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1219810-16-8 | ChEBI |
| Citations |
|---|