EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36ClN3O7 |
| Net Charge | 0 |
| Average Mass | 586.085 |
| Monoisotopic Mass | 585.22418 |
| SMILES | C[C@@H]1CC[C@@]23C[C@H](O)C(=O)[C@@]2(O)[C@]1(C)[C@H](OC(=O)CCl)C[C@@H](C1=CCn2c(=O)n(-c4ccccc4)c(=O)n2C1)[C@@H]3C |
| InChI | InChI=1S/C30H36ClN3O7/c1-17-9-11-29-14-22(35)25(37)30(29,40)28(17,3)23(41-24(36)15-31)13-21(18(29)2)19-10-12-32-26(38)34(27(39)33(32)16-19)20-7-5-4-6-8-20/h4-8,10,17-18,21-23,35,40H,9,11-16H2,1-3H3/t17-,18+,21-,22+,23-,28+,29+,30-/m1/s1 |
| InChIKey | LLYJISDUHFXOHK-GOCONZMPSA-N |
| Roles Classification |
|---|
| Biological Roles: | thioredoxin inhibitor Any substance which inhibits thioredoxin, a group of small redox proteins. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferroptocide (CHEBI:173106) has role antineoplastic agent (CHEBI:35610) |
| ferroptocide (CHEBI:173106) has role ferroptosis inducer (CHEBI:173085) |
| ferroptocide (CHEBI:173106) has role thioredoxin inhibitor (CHEBI:173108) |
| ferroptocide (CHEBI:173106) is a benzenes (CHEBI:22712) |
| ferroptocide (CHEBI:173106) is a carbotricyclic compound (CHEBI:38032) |
| ferroptocide (CHEBI:173106) is a carboxylic ester (CHEBI:33308) |
| ferroptocide (CHEBI:173106) is a cyclic ketone (CHEBI:3992) |
| ferroptocide (CHEBI:173106) is a organochlorine compound (CHEBI:36683) |
| ferroptocide (CHEBI:173106) is a secondary alcohol (CHEBI:35681) |
| ferroptocide (CHEBI:173106) is a tertiary alcohol (CHEBI:26878) |
| ferroptocide (CHEBI:173106) is a triazolopyridazine (CHEBI:48384) |
| IUPAC Name |
|---|
| (2S,3aS,4S,5R,7R,8S,8aS,9R)-5-(1,3-dioxo-2-phenyl-2,3,5,8-tetrahydro-1H-[1,2,4]triazolo[1,2-a]pyridazin-6-yl)-2,8a-dihydroxy-4,8,9-trimethyl-1-oxooctahydro-1H-3a,8-propanoazulen-7-yl chloroacetate |
| Synonym | Source |
|---|---|
| FTC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2020210158 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:34613802 | Reaxys |
| Citations |
|---|