EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41NO3 |
| Net Charge | 0 |
| Average Mass | 487.684 |
| Monoisotopic Mass | 487.30864 |
| SMILES | [H][C@]12CC[C@H](C)C[C@]1(C)C=C(C)[C@H](/C(C)=C/C(C)CC)[C@@H]2C(=O)C1=C/C(=C/c2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C32H41NO3/c1-7-19(2)14-21(4)28-22(5)18-32(6)17-20(3)8-13-27(32)29(28)30(35)26-16-24(33-31(26)36)15-23-9-11-25(34)12-10-23/h9-12,14-16,18-20,27-29,34H,7-8,13,17H2,1-6H3,(H,33,36)/b21-14+,24-15-/t19?,20-,27+,28-,29+,32+/m0/s1 |
| InChIKey | QCTUYJGFLVZOTL-NKPJVERHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces purpureogenus (ncbitaxon:1266744) | - | PubMed (30520578) | |
| Cladosporium sp. (ncbitaxon:1707700) | - | PubMed (30577517) | Strain: HNWSW-1 |
| Talaromyces convolutus (ncbitaxon:1131474) | - | PubMed (10869198) |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talaroconvolutin A (CHEBI:173105) has role antineoplastic agent (CHEBI:35610) |
| talaroconvolutin A (CHEBI:173105) has role ferroptosis inducer (CHEBI:173085) |
| talaroconvolutin A (CHEBI:173105) has role fungal metabolite (CHEBI:76946) |
| talaroconvolutin A (CHEBI:173105) is a ketone (CHEBI:17087) |
| talaroconvolutin A (CHEBI:173105) is a octahydronaphthalenes (CHEBI:138397) |
| talaroconvolutin A (CHEBI:173105) is a olefinic compound (CHEBI:78840) |
| talaroconvolutin A (CHEBI:173105) is a phenols (CHEBI:33853) |
| talaroconvolutin A (CHEBI:173105) is a pyrroline (CHEBI:23763) |
| IUPAC Name |
|---|
| (5Z)-5-(4-hydroxybenzylidene)-3-({(1R,2S,4aS,6S,8aR)-3,4a,6-trimethyl-2-[(2E)-4-methylhex-2-en-2-yl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl}carbonyl)-1,5-dihydro-2H-pyrrol-2-one |
| Synonyms | Source |
|---|---|
| TalaA | ChEBI |
| (−)-talaroconvolutin A | KNApSAcK |
| Citations |
|---|