EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H61N5O7S |
| Net Charge | 0 |
| Average Mass | 707.979 |
| Monoisotopic Mass | 707.42917 |
| SMILES | [H][C@@]12[C@@H](C(=O)N[C@@H](CCCC)C(=O)C(=O)NC3CC3)N(C(=O)[C@@H](NC(=O)NC3(CS(=O)(=O)C(C)(C)C)CCCCC3)C(C)(C)C)C[C@]1([H])C2(C)C |
| InChI | InChI=1S/C36H61N5O7S/c1-10-11-15-24(27(42)30(44)37-22-16-17-22)38-29(43)26-25-23(35(25,8)9)20-41(26)31(45)28(33(2,3)4)39-32(46)40-36(18-13-12-14-19-36)21-49(47,48)34(5,6)7/h22-26,28H,10-21H2,1-9H3,(H,37,44)(H,38,43)(H2,39,40,46)/t23-,24-,25-,26-,28+/m0/s1 |
| InChIKey | RICZEKWVNZFTNZ-LFGITCQGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| narlaprevir (CHEBI:173104) has role anticoronaviral agent (CHEBI:149553) |
| narlaprevir (CHEBI:173104) has role antiviral drug (CHEBI:36044) |
| narlaprevir (CHEBI:173104) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| narlaprevir (CHEBI:173104) has role hepatitis C protease inhibitor (CHEBI:64924) |
| narlaprevir (CHEBI:173104) is a azabicyclohexane (CHEBI:170008) |
| narlaprevir (CHEBI:173104) is a cyclopropanes (CHEBI:51454) |
| narlaprevir (CHEBI:173104) is a pyrrolidinecarboxamide (CHEBI:46770) |
| narlaprevir (CHEBI:173104) is a secondary carboxamide (CHEBI:140325) |
| narlaprevir (CHEBI:173104) is a sulfone (CHEBI:35850) |
| narlaprevir (CHEBI:173104) is a tertiary carboxamide (CHEBI:140326) |
| narlaprevir (CHEBI:173104) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (1R,2S,5S)-3-[N-({1-[(tert-butylsulfonyl)methyl]cyclohexyl}carbamoyl)-3-methyl-L-valyl]-N-[(3S)-1-(cyclopropylamino)-1,2-dioxoheptan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| INNs | Source |
|---|---|
| narlaprevir | WHO MedNet |
| narlaprevir | WHO MedNet |
| narlaprévir | WHO MedNet |
| narlaprevirum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,2S,5S)-3-{(2S)-2-[({1-[(tert-butylsulfonyl)methyl]cyclohexyl}carbamoyl)amino]-3,3-dimethylbutanoyl}-N-[(3S)-1-(cyclopropylamino)-1,2-dioxoheptan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide | IUPAC |
| (1R,2S,5S)-N-[(3S)-1-(cyclopropylamino)-1,2-dioxoheptan-3-yl]-6,6-dimethyl-3-[3-methyl-N-({1-[(2-methylpropane-2-sulfonyl)methyl]cyclohexyl}carbamoyl)-L-valyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide | IUPAC |
| SCH 900518 | ChemIDplus |
| SCH-900518 | ChemIDplus |
| SCH900518 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Arlansa | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:865466-24-6 | ChemIDplus |
| Citations |
|---|