EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H61N5O7S |
| Net Charge | 0 |
| Average Mass | 707.979 |
| Monoisotopic Mass | 707.42917 |
| SMILES | [H][C@@]12[C@@H](C(=O)N[C@@H](CCCC)C(=O)C(=O)NC3CC3)N(C(=O)[C@@H](NC(=O)NC3(CS(=O)(=O)C(C)(C)C)CCCCC3)C(C)(C)C)C[C@]1([H])C2(C)C |
| InChI | InChI=1S/C36H61N5O7S/c1-10-11-15-24(27(42)30(44)37-22-16-17-22)38-29(43)26-25-23(35(25,8)9)20-41(26)31(45)28(33(2,3)4)39-32(46)40-36(18-13-12-14-19-36)21-49(47,48)34(5,6)7/h22-26,28H,10-21H2,1-9H3,(H,37,44)(H,38,43)(H2,39,40,46)/t23-,24-,25-,26-,28+/m0/s1 |
| InChIKey | RICZEKWVNZFTNZ-LFGITCQGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| narlaprevir (CHEBI:173104) has role anticoronaviral agent (CHEBI:149553) |
| narlaprevir (CHEBI:173104) has role antiviral drug (CHEBI:36044) |
| narlaprevir (CHEBI:173104) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| narlaprevir (CHEBI:173104) has role hepatitis C protease inhibitor (CHEBI:64924) |
| narlaprevir (CHEBI:173104) is a azabicyclohexane (CHEBI:170008) |
| narlaprevir (CHEBI:173104) is a cyclopropanes (CHEBI:51454) |
| narlaprevir (CHEBI:173104) is a pyrrolidinecarboxamide (CHEBI:46770) |
| narlaprevir (CHEBI:173104) is a secondary carboxamide (CHEBI:140325) |
| narlaprevir (CHEBI:173104) is a sulfone (CHEBI:35850) |
| narlaprevir (CHEBI:173104) is a tertiary carboxamide (CHEBI:140326) |
| narlaprevir (CHEBI:173104) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (1R,2S,5S)-3-[N-({1-[(tert-butylsulfonyl)methyl]cyclohexyl}carbamoyl)-3-methyl-L-valyl]-N-[(3S)-1-(cyclopropylamino)-1,2-dioxoheptan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| INNs | Source |
|---|---|
| narlaprevir | WHO MedNet |
| narlaprevir | WHO MedNet |
| narlaprévir | WHO MedNet |
| narlaprevirum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,2S,5S)-3-{(2S)-2-[({1-[(tert-butylsulfonyl)methyl]cyclohexyl}carbamoyl)amino]-3,3-dimethylbutanoyl}-N-[(3S)-1-(cyclopropylamino)-1,2-dioxoheptan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide | IUPAC |
| (1R,2S,5S)-N-[(3S)-1-(cyclopropylamino)-1,2-dioxoheptan-3-yl]-6,6-dimethyl-3-[3-methyl-N-({1-[(2-methylpropane-2-sulfonyl)methyl]cyclohexyl}carbamoyl)-L-valyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide | IUPAC |
| SCH 900518 | ChemIDplus |
| SCH-900518 | ChemIDplus |
| SCH900518 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Arlansa | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:865466-24-6 | ChemIDplus |
| Citations |
|---|