EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:173098 - PD-146176
| Formula | C15H11NS |
| Net Charge | 0 |
| Average Mass | 237.327 |
| Monoisotopic Mass | 237.06122 |
| SMILES | c1ccc2c(c1)SCc1c-2nc2ccccc12 |
| InChI | InChI=1S/C15H11NS/c1-3-7-13-10(5-1)12-9-17-14-8-4-2-6-11(14)15(12)16-13/h1-8,16H,9H2 |
| InChIKey | ZGOOPZVQMLHPFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). |
| Application: | antiatherogenic agent A cardiovascular drug that prevents atherogenesis, the accumulation of lipid-containing plaques on the innermost layers of the arteries. Compare with antiatherosclerotic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD-146176 (CHEBI:173098) has role antiatherogenic agent (CHEBI:50855) |
| PD-146176 (CHEBI:173098) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| PD-146176 (CHEBI:173098) has role ferroptosis inhibitor (CHEBI:173084) |
| PD-146176 (CHEBI:173098) is a organic heterotetracyclic compound (CHEBI:38163) |
| PD-146176 (CHEBI:173098) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| PD-146176 (CHEBI:173098) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| 6,11-dihydrothiochromeno[4,3-b]indole |
| Synonyms | Source |
|---|---|
| 6,11-dihydro[1]benzothiopyrano[4,3-b]indole | IUPAC |
| PD146176 | ChEBI |
| PD 146176 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:4079-26-9 | ChemIDplus |
| Citations |
|---|