EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21ClN4 |
| Net Charge | 0 |
| Average Mass | 340.858 |
| Monoisotopic Mass | 340.14547 |
| SMILES | Clc1cccc(CNC2=Nc3ccccc3NC23CCNCC3)c1 |
| InChI | InChI=1S/C19H21ClN4/c20-15-5-3-4-14(12-15)13-22-18-19(8-10-21-11-9-19)24-17-7-2-1-6-16(17)23-18/h1-7,12,21,24H,8-11,13H2,(H,22,23) |
| InChIKey | YAFQFNOUYXZVPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liproxstatin-1 (CHEBI:173097) has role antioxidant (CHEBI:22586) |
| liproxstatin-1 (CHEBI:173097) has role cardioprotective agent (CHEBI:77307) |
| liproxstatin-1 (CHEBI:173097) has role ferroptosis inhibitor (CHEBI:173084) |
| liproxstatin-1 (CHEBI:173097) has role radical scavenger (CHEBI:48578) |
| liproxstatin-1 (CHEBI:173097) is a azaspiro compound (CHEBI:35624) |
| liproxstatin-1 (CHEBI:173097) is a monochlorobenzenes (CHEBI:83403) |
| liproxstatin-1 (CHEBI:173097) is a organic heterotricyclic compound (CHEBI:26979) |
| liproxstatin-1 (CHEBI:173097) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-(3-chlorobenzyl)-1'H-spiro[piperidine-4,2'-quinoxalin]-3'-amine |
| Synonyms | Source |
|---|---|
| N-[(3-chlorophenyl)methyl]-1'H-spiro[piperidine-4,2'-quinoxalin]-3'-amine | IUPAC |
| Lip-1 | ChEBI |
| liproxstatin 1 | ChEBI |
| liproxstatin1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 20387119 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:950455-15-9 | ChEBI |
| Citations |
|---|