EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32N4O2 |
| Net Charge | 0 |
| Average Mass | 432.568 |
| Monoisotopic Mass | 432.25253 |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC23CC4CC(CC(C4)C2)C3)c(/N=C\c2cncnc2)c1 |
| InChI | InChI=1S/C26H32N4O2/c1-25(2,3)32-24(31)21-4-5-22(23(9-21)29-15-20-13-27-16-28-14-20)30-26-10-17-6-18(11-26)8-19(7-17)12-26/h4-5,9,13-19,30H,6-8,10-12H2,1-3H3/b29-15- |
| InChIKey | DFENTOUMMDWZAF-FDVSRXAVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SRS16-86 (CHEBI:173096) has role ferroptosis inhibitor (CHEBI:173084) |
| SRS16-86 (CHEBI:173096) is a tert-butyl ester (CHEBI:140402) |
| SRS16-86 (CHEBI:173096) is a adamantanes (CHEBI:51339) |
| SRS16-86 (CHEBI:173096) is a imine (CHEBI:24783) |
| SRS16-86 (CHEBI:173096) is a pyrimidines (CHEBI:39447) |
| SRS16-86 (CHEBI:173096) is a secondary amino compound (CHEBI:50995) |
| SRS16-86 (CHEBI:173096) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| tert-butyl 3-[(Z)-(pyrimidin-5-ylmethylidene)amino]-4-(tricyclo[3.3.1.13,7]decan-1-ylamino)benzoate |
| Synonyms | Source |
|---|---|
| tert-butyl 4-[(adamantan-1-yl)amino]-3-{(Z)-[(pyrimidin-5-yl)methylidene]amino}benzoate | IUPAC |
| 3-[(Z)-(5-pyrimidinylmethylene)amino]-4-(tricyclo[3.3.1.13,7]dec-1-ylamino)-benzoic acid 1,1-dimethylethyl ester | ChEBI |
| SRS 16-86 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1793052-96-6 | ChEBI |
| Citations |
|---|