EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17Cl2NO4S |
| Net Charge | 0 |
| Average Mass | 366.266 |
| Monoisotopic Mass | 365.02553 |
| SMILES | CCOc1cc(Cl)c(CS(=O)(=O)C2=NOC(C)(C)C2)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO4S/c1-4-20-12-6-10(15)9(5-11(12)16)8-22(18,19)13-7-14(2,3)21-17-13/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | ACDZDIIWZVQMIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoxasulfone (CHEBI:173078) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| fenoxasulfone (CHEBI:173078) has role herbicide (CHEBI:24527) |
| fenoxasulfone (CHEBI:173078) is a aromatic ether (CHEBI:35618) |
| fenoxasulfone (CHEBI:173078) is a dichlorobenzene (CHEBI:23697) |
| fenoxasulfone (CHEBI:173078) is a isoxazoles (CHEBI:55373) |
| fenoxasulfone (CHEBI:173078) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 3-[(2,5-dichloro-4-ethoxybenzyl)sulfonyl]-5,5-dimethyl-4,5-dihydro-1,2-oxazole |
| Synonyms | Source |
|---|---|
| 3-[(2,5-dichloro-4-ethoxyphenyl)methanesulfonyl]-5,5-dimethyl-4,5-dihydro-1,2-oxazole | IUPAC |
| 2,5-dichloro-4-{[(5,5-dimethyl-4,5-dihydroisoxazol-3-yl)sulfonyl]methyl}phenyl ethyl ether | Alan Wood's Pesticides |
| 2,5-dichloro-α-[(4,5-dihydro-5,5-dimethylisoxazol-3-yl)sulfonyl]-p-tolyl ethyl ether | Alan Wood's Pesticides |
| 3-[[(2,5-dichloro-4-ethoxyphenyl)methyl]sulfonyl]-4,5-dihydro-5,5-dimethylisoxazole | Alan Wood's Pesticides |
| KIH-1419 | PPDB |
| fenoxasulphone | PPDB |
| Manual Xrefs | Databases |
|---|---|
| fenoxasulfone | Alan Wood's Pesticides |
| 1653 | PPDB |
| 21442063 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:639826-16-7 | Alan Wood's Pesticides |
| Citations |
|---|