EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CCC/C2=C\C=C1/C[C@@H](O)CC/C1=C\C |
| InChI | InChI=1S/C28H46O/c1-6-22-14-15-25(29)19-24(22)13-12-23-11-8-18-28(5)26(16-17-27(23)28)21(4)10-7-9-20(2)3/h6,12-13,20-21,25-27,29H,7-11,14-19H2,1-5H3/b22-6+,23-12+,24-13+/t21-,25+,26-,27+,28-/m1/s1 |
| InChIKey | GIRFRBWCDSDWHK-JTGCWGEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | brain (BTO:0000142) | MetaboLights (MTBLS2457) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5E,7E,10E)-(3S)-19-methyl-9,10-seco-5,7,10(19)-cholestatrien-3-ol (CHEBI:173069) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3E,4E)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-ethylidenecyclohexan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 4446863 | ChemSpider |
| LMST03020335 | LIPID MAPS |