EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1(O)CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O3/c1-17-9-10-19(22)15(14(17)5-6-16(17)21)4-3-12-11-13(20)7-8-18(12,19)2/h7-8,11,14-16,21-22H,3-6,9-10H2,1-2H3/t14-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | BDTCDYJFOLOAGO-KOUJMVCDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | brain (BTO:0000142) | MetaboLights (MTBLS2457) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,17beta-hydroxy-androsta-1,4-dien-3-one (CHEBI:173053) has role androgen (CHEBI:50113) |
| 9,17beta-hydroxy-androsta-1,4-dien-3-one (CHEBI:173053) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (8S,9R,10S,13S,14S,17S)-9,17-dihydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| LMST02020114 | LIPID MAPS |