EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12CCC3=C(O)C(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O3/c1-18-10-8-15(20)17(22)14(18)4-3-11-12-5-6-16(21)19(12,2)9-7-13(11)18/h11-13,16,21-22H,3-10H2,1-2H3/t11-,12-,13-,16-,18+,19-/m0/s1 |
| InChIKey | BQOIJSIMMIDHMO-FBPKJDBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | brain (BTO:0000142) | MetaboLights (MTBLS2457) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxytestosterone (CHEBI:173052) has role androgen (CHEBI:50113) |
| 4-Hydroxytestosterone (CHEBI:173052) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (8R,9S,10R,13S,14S,17S)-4,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 141138 | ChemSpider |
| DB01485 | DrugBank |
| LMST02020102 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2141-17-5 | ChemIDplus |