EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(C)=C(C)C |
| InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,20,22-26,29H,7-8,10-17H2,1-6H3/t20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | YTFTXKBJICNYCV-PXBBAZSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ircinia mutans (WORMS:165034) | - | PubMed (34043935) | |
| Lycium barbarum (ncbitaxon:112863) | - | PubMed (38961030) | |
| Lycium ruthenicum (ncbitaxon:112879) | - | PubMed (30178878) | |
| Mortierella alpina (ncbitaxon:64518) | mycelium (BTO:0001436) | PubMed (16647729) | |
| Mus musculus (ncbitaxon:10090) | brain (BTO:0000142) | MetaboLights (MTBLS2457) | Strain: C57BL/6J [EFO:0000606] |
| Tetraselmis chui (ncbitaxon:63592) | - | PubMed (15540591) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) has role algal metabolite (CHEBI:84735) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) has role fungal metabolite (CHEBI:76946) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) has role plant metabolite (CHEBI:76924) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) is a 3β-sterol (CHEBI:35348) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) is a C28-steroid (CHEBI:188921) |
| 24-methylcholesta-5,24-dien-3β-ol (CHEBI:172991) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| ergosta-5,24-dien-3β-ol |
| Synonyms | Source |
|---|---|
| 24-methyl-24,25-didehydrocholesterol | ChEBI |
| 24-methylcholesta-5,24(25)-dien-3β-ol | ChEBI |
| 24-methylcholesta-5,24-dien-3β-ol | ChEBI |
| 24-methyldesmosterol | ChemSpider |
| UniProt Name | Source |
|---|---|
| 24-methylcholesta-5,24-dien-3β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 167978 | ChemSpider |
| LMST01030110 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:20780-41-0 | PubChem Compound |
| Citations |
|---|