EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O |
| Net Charge | 0 |
| Average Mass | 384.648 |
| Monoisotopic Mass | 384.33922 |
| SMILES | [H]C(=C=C1CCC[C@]2(C)[C@@]([H])([C@]([H])(C)CCCC(C)C)CC[C@@]12[H])C1=C(C)CC[C@H](O)C1 |
| InChI | InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h13,19,21,24-26,28H,6-11,14-18H2,1-5H3/t12-,21-,24+,25-,26+,27-/m1/s1 |
| InChIKey | YZGASHZUSKGPDO-WZRNXNRTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | brain (BTO:0000142) | MetaboLights (MTBLS2457) | Strain: C57BL/6J |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,6S)-9,10-seco-5(10),6,7-cholestatrien-3-ol (CHEBI:172963) is a vitamin D (CHEBI:27300) |
| Manual Xrefs | Databases |
|---|---|
| LMST03020228 | LIPID MAPS |