EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17F3N3O5.Na |
| Net Charge | 0 |
| Average Mass | 471.367 |
| Monoisotopic Mass | 471.10180 |
| SMILES | [H][C@@]12CC[C@@]([H])(C1)N1C(=O)c3c([O-])c(=O)c(C(=O)NCc4c(F)cc(F)cc4F)cn3C[C@@]1([H])O2.[Na+] |
| InChI | InChI=1S/C21H18F3N3O5.Na/c22-9-3-14(23)12(15(24)4-9)6-25-20(30)13-7-26-8-16-27(10-1-2-11(5-10)32-16)21(31)17(26)19(29)18(13)28;/h3-4,7,10-11,16,29H,1-2,5-6,8H2,(H,25,30);/q;+1/p-1/t10-,11+,16+;/m0./s1 |
| InChIKey | WJNFBIVCQMPPJC-FQYDJHLKSA-M |
| Roles Classification |
|---|
| Biological Role: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bictegravir sodium (CHEBI:172961) has part bictegravir(1−) (CHEBI:172960) |
| bictegravir sodium (CHEBI:172961) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| bictegravir sodium (CHEBI:172961) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (2R,5S,13aR)-7,9-dioxo-10-[(2,4,6-trifluorobenzyl)carbamoyl]-2,3,4,5,7,9,13,13a-octahydro-2,5-methanopyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazepin-8-olate |
| Manual Xrefs | Databases |
|---|---|
| DBSALT002077 | DrugBank |
| D10910 | KEGG DRUG |
| 48772870 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1807988-02-8 | ChemIDplus |
| Citations |
|---|