EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@]12C[C@](C)(C/C=C3\[C@](C)(CC[C@]4(C)CC[C@H](C(=C)C)[C@@]34[H])C1)CC[C@@H]2C |
| InChI | InChI=1S/C25H40/c1-17(2)20-8-12-24(5)13-14-25(6)16-19-15-23(4,10-7-18(19)3)11-9-21(25)22(20)24/h9,18-20,22H,1,7-8,10-16H2,2-6H3/b21-9-/t18-,19-,20+,22-,23-,24-,25+/m0/s1 |
| InChIKey | PKKHDWUOTCTVFH-UWLZFXEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (27038368) | Strain: NSAR1 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astellifadiene (CHEBI:172939) has role Aspergillus metabolite (CHEBI:76956) |
| astellifadiene (CHEBI:172939) is a polycyclic olefin (CHEBI:35714) |
| astellifadiene (CHEBI:172939) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| [1S,3aS,5aR,7S,8S,11R,13(13a)Z,13bR]-3a,5a,8,11-tetramethyl-1-(prop-1-en-2-yl)-2,3,3a,4,5,5a,6,7,8,9,10,11,12,13b-tetradecahydro-1H-7,11-methanocyclodeca[e]indene |
| UniProt Name | Source |
|---|---|
| astellifadiene | UniProt |
| Citations |
|---|