EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@@]12C[C@]3([H])/C(C)=C/CC/C(C)=C/CCC(=C)[C@@]3([H])C[C@@]1(C)CC[C@@H]2C(C)C |
| InChI | InChI=1S/C25H40/c1-17(2)21-13-14-25(6)16-23-20(5)12-8-10-18(3)9-7-11-19(4)22(23)15-24(21)25/h10-11,17,21-24H,5,7-9,12-16H2,1-4,6H3/b18-10+,19-11+/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | XHQMHRRRDVHUPL-STTJJXKTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (28350168) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-thalianatriene (CHEBI:172937) has role plant metabolite (CHEBI:76924) |
| (+)-thalianatriene (CHEBI:172937) is a carbotricyclic compound (CHEBI:38032) |
| (+)-thalianatriene (CHEBI:172937) is a polycyclic olefin (CHEBI:35714) |
| (+)-thalianatriene (CHEBI:172937) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (1R,3aR,4aS,8E,12E,13aS,14aS)-3a,9,13-trimethyl-5-methylidene-1-(propan-2-yl)-1,2,3,3a,4,4a,5,6,7,10,11,13a,14,14a-tetradecahydrocycloundeca[f]indene |
| Manual Xrefs | Databases |
|---|---|
| 62702347 | ChemSpider |
| Citations |
|---|