EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CC[C@@]3(C)[C@@H](O)[C@]1([H])C(C)(C)CCC[C@@]23C |
| InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)10-6-9-15(14,4)12(16)11(10)13/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+,14+,15+/m1/s1 |
| InChIKey | MNNFKQAYXGEKFA-MUGBGTHKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus densiflora (ncbitaxon:77912) | - | PubMed (24263436) |
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| longiborneol (CHEBI:172936) has role insect attractant (CHEBI:24850) |
| longiborneol (CHEBI:172936) has role plant metabolite (CHEBI:76924) |
| longiborneol (CHEBI:172936) is a carbotricyclic compound (CHEBI:38032) |
| longiborneol (CHEBI:172936) is a secondary alcohol (CHEBI:35681) |
| longiborneol (CHEBI:172936) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1R,3aR,4S,8aS,9S)-1,5,5,8a-tetramethyldecahydro-1,4-methanoazulen-9-ol |
| Synonyms | Source |
|---|---|
| (1R,3aR,4S,8aS,9S)-(+)-decahydro-1,5,5,8a-tetramethyl-1,4-methanoazulen-9-ol | ChEBI |
| (1R,3aR,4S,8aS,9S)-decahydro-1,5,5,8a-tetramethyl-1,4-methanoazulen-9-ol | ChEBI |
| (+)-juniperol | ChEBI |
| juniperol | ChEBI |
| (+)-longiborneol | ChEBI |
| UniProt Name | Source |
|---|---|
| longiborneol | UniProt |
| Citations |
|---|