EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@@](C)(C=C)[C@@H](C(=C)C)[C@]1([H])C2(C)C |
| InChI | InChI=1S/C15H24/c1-7-15(6)9-8-11-13(14(11,4)5)12(15)10(2)3/h7,11-13H,1-2,8-9H2,3-6H3/t11-,12+,13-,15-/m1/s1 |
| InChIKey | LKQMMFFQYMYQOJ-QVHKTLOISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alphonsea gaudichaudiana (IPNI:77070651-1) | leaf (BTO:0000713) | PubMed (23879263) | |
| Alphonsea philastreana (IPNI:72006-1) | leaf (BTO:0000713) | PubMed (23879263) | |
| Annona reticulata (ncbitaxon:301862) | - | PubMed (22989376) | |
| Clausena engleri (IPNI:772125-1) | leaf (BTO:0000713) | PubMed (24617735) | |
| Dasymaschalon glaucum (IPNI:72734-1) | leaf (BTO:0000713) | PubMed (24236527) | |
| Flourensia campestris (IPNI:208174-1) | leaf (BTO:0000713) | PubMed (22245633) | |
| Lunasia amara (IPNI:137666-3) | leaf (BTO:0000713) | DOI (10.1080/10412905.1997.9699450) | |
| Melodorum fruticosum (ncbitaxon:174966) | leaf (BTO:0000713) | PubMed (23513739) | |
| Nepeta daenensis (IPNI:452372-1) | - | DOI (10.1080/10412905.2005.9698995) | |
| Piper retrofractum (IPNI:683079-1) | leaf (BTO:0000713) | PubMed (24712088) | |
| Polyalthia harmandii (IPNI:74592-1) | - | PubMed (24520907) | |
| Polyalthia jucunda (IPNI:74609-1) | - | PubMed (24520907) | |
| Polyalthia thorelii (IPNI:74744-1) | - | PubMed (24520907) | |
| Rollinia sericea (IPNI:221796-2) | leaf (BTO:0000713) | DOI (10.1080/10412905.2010.9700361) |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bicycloelemene (CHEBI:172935) has role volatile oil component (CHEBI:27311) |
| bicycloelemene (CHEBI:172935) is a a bicycloelemene (CHEBI:193106) |
| bicycloelemene (CHEBI:172935) is a carbobicyclic compound (CHEBI:36785) |
| bicycloelemene (CHEBI:172935) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1R,2R,3S,6R)-3-ethenyl-3,7,7-trimethyl-2-(prop-1-en-2-yl)bicyclo[4.1.0]heptane |
| Synonym | Source |
|---|---|
| (−)-bicycloelemene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00011971 | KNApSAcK |
| FDB017397 | FooDB |
| HMDB0038166 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:32531-56-9 | NIST Chemistry WebBook |
| CAS:32531-56-9 | ChemIDplus |
| Citations |
|---|