EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | CC(C)=CCC/C(C)=C\CCC1(C)C2CC3C(C2)C31C |
| InChI | InChI=1S/C20H32/c1-14(2)8-6-9-15(3)10-7-11-19(4)16-12-17-18(13-16)20(17,19)5/h8,10,16-18H,6-7,9,11-13H2,1-5H3/b15-10- |
| InChIKey | RWQXKZBEXSHTGG-GDNBJRDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | - | PubMed (25786135) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lycosantalene (CHEBI:172930) has role plant metabolite (CHEBI:76924) |
| lycosantalene (CHEBI:172930) is a carbotricyclic compound (CHEBI:38032) |
| lycosantalene (CHEBI:172930) is a diterpene (CHEBI:35190) |
| lycosantalene (CHEBI:172930) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 7-[(3Z)-4,8-dimethylnona-3,7-dien-1-yl]-1,7-dimethyltricyclo[2.2.1.02,6]heptane |
| Manual Xrefs | Databases |
|---|---|
| CPD-23415 | MetaCyc |
| Citations |
|---|