EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@]12CC=C(C)CC2 |
| InChI | InChI=1S/C15H24/c1-11(2)14-6-5-13(4)15(14)9-7-12(3)8-10-15/h7,13-14H,1,5-6,8-10H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | DVBSKQAFCDJNSL-QLFBSQMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia annua (ncbitaxon:35608) | - | DOI (10.1006/abbi.1999.1358) | |
| Cupressus sempervirens (ncbitaxon:13469) | - | DOI (10.1080/14786419.2012.755680) | |
| Solanum habrochaites (ncbitaxon:62890) | - | PubMed (21818683) |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-acoradiene (CHEBI:172926) has role volatile oil component (CHEBI:27311) |
| α-acoradiene (CHEBI:172926) is a sesquiterpene (CHEBI:35189) |
| α-acoradiene (CHEBI:172926) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (1R,4S,5S)-1,8-dimethyl-4-(prop-1-en-2-yl)spiro[4.5]dec-7-ene |
| Synonyms | Source |
|---|---|
| acoradiene | ChemIDplus |
| alpha-acoradiene | KNApSAcK |
| (−)-α-acoradiene | KNApSAcK |
| UniProt Name | Source |
|---|---|
| α-acoradiene | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:24048-44-0 | ChemIDplus |
| Citations |
|---|