EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | CCOc1cc(CCC(C)=O)ccc1O |
| InChI | InChI=1S/C12H16O3/c1-3-15-12-8-10(5-4-9(2)13)6-7-11(12)14/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | MXLOKFOWFPJWCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial cosmetic preservative An antimicrobial agent that is added to cosmetic formulations to maintain the microbiological safety of the products by inhibiting the growth of fungi or bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylzingerone (CHEBI:172922) has role antibacterial agent (CHEBI:33282) |
| ethylzingerone (CHEBI:172922) has role antifungal agent (CHEBI:35718) |
| ethylzingerone (CHEBI:172922) has role antimicrobial cosmetic preservative (CHEBI:172949) |
| ethylzingerone (CHEBI:172922) is a aromatic ether (CHEBI:35618) |
| ethylzingerone (CHEBI:172922) is a methyl ketone (CHEBI:51867) |
| ethylzingerone (CHEBI:172922) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one |
| Synonyms | Source |
|---|---|
| hydroxyethoxyphenyl butanone | ChemIDplus |
| HEPB | SUBMITTER |
| 4-(3-ethoxy-4-hydroxyphenyl)-2-butanone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 24208550 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:569646-79-3 | ChemIDplus |
| Citations |
|---|