EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | CCOc1cc(CCC(C)=O)ccc1O |
| InChI | InChI=1S/C12H16O3/c1-3-15-12-8-10(5-4-9(2)13)6-7-11(12)14/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | MXLOKFOWFPJWCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial cosmetic preservative An antimicrobial agent that is added to cosmetic formulations to maintain the microbiological safety of the products by inhibiting the growth of fungi or bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylzingerone (CHEBI:172922) has role antibacterial agent (CHEBI:33282) |
| ethylzingerone (CHEBI:172922) has role antifungal agent (CHEBI:35718) |
| ethylzingerone (CHEBI:172922) has role antimicrobial cosmetic preservative (CHEBI:172949) |
| ethylzingerone (CHEBI:172922) is a aromatic ether (CHEBI:35618) |
| ethylzingerone (CHEBI:172922) is a methyl ketone (CHEBI:51867) |
| ethylzingerone (CHEBI:172922) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one |
| Synonyms | Source |
|---|---|
| 4-(3-ethoxy-4-hydroxyphenyl)-2-butanone | ChemIDplus |
| HEPB | SUBMITTER |
| hydroxyethoxyphenyl butanone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 24208550 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:569646-79-3 | ChemIDplus |
| Citations |
|---|