EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O5 |
| Net Charge | 0 |
| Average Mass | 230.220 |
| Monoisotopic Mass | 230.09027 |
| SMILES | CC(=O)N[C@@H](CC[C@]1(O)CNC1=O)C(=O)O |
| InChI | InChI=1S/C9H14N2O5/c1-5(12)11-6(7(13)14)2-3-9(16)4-10-8(9)15/h6,16H,2-4H2,1H3,(H,10,15)(H,11,12)(H,13,14)/t6-,9-/m0/s1 |
| InChIKey | NWALZXMQMQDKNJ-RCOVLWMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gallus gallus (ncbitaxon:9031) | blood plasma (BTO:0000131) | MetaboLights (MTBLS1274) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1-Acetyl-tabtoxinine-beta-lactam (CHEBI:172915) is a monobactam (CHEBI:50695) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-4-[(3S)-3-hydroxy-2-oxoazetidin-3-yl]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C20921 | KEGG COMPOUND |