EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3S |
| Net Charge | 0 |
| Average Mass | 220.294 |
| Monoisotopic Mass | 220.08816 |
| SMILES | CSCCC(NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C8H16N2O3S/c1-5(9)7(11)10-6(8(12)13)3-4-14-2/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | FSHURBQASBLAPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alanyl-Methionine (CHEBI:172911) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-(2-aminopropanoylamino)-4-methylsulanylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028693 | HMDB |
| 88964 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1999-43-5 | ChemIDplus |