EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O14P3 |
| Net Charge | -4 |
| Average Mass | 519.149 |
| Monoisotopic Mass | 518.96155 |
| SMILES | Nc1nc(=O)nc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O14P3/c11-7-4-8(14-10(18)13-7)15(2-12-4)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/p-4/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DJHOBIUAJLDRDQ-UUOKFMHZSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxo-ATP(4−) (CHEBI:172878) is a nucleoside 5'-triphoshate(4−) (CHEBI:61557) |
| 2-oxo-ATP(4−) (CHEBI:172878) is tautomer of 2-hydroxy-ATP(4−) (CHEBI:169970) |
| Incoming Relation(s) |
| 2-hydroxy-ATP(4−) (CHEBI:169970) is tautomer of 2-oxo-ATP(4−) (CHEBI:172878) |
| Synonyms | Source |
|---|---|
| 2-oxo-ATP tetraanion | SUBMITTER |
| 2-oxo-adenosine 5'-triphosphate tetraanion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2-oxo-ATP | UniProt |
| Citations |
|---|