EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14CoO4 |
| Net Charge | 0 |
| Average Mass | 257.151 |
| Monoisotopic Mass | 257.02240 |
| SMILES | CC1=[O][Co+2]2([O]=C(C)[CH-]1)[O]=C(C)[CH-]C(C)=[O]2 |
| InChI | InChI=1S/2C5H7O2.Co/c2*1-4(6)3-5(2)7;/h2*3H,1-2H3;/q2*-1;+2 |
| InChIKey | BKFAZDGHFACXKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobalt(II) bis(acetylacetonate) (CHEBI:172875) has role catalyst (CHEBI:35223) |
| cobalt(II) bis(acetylacetonate) (CHEBI:172875) is a cobalt coordination entity (CHEBI:33890) |
| IUPAC Name |
|---|
| bis(pentane-2,4-dionato-κ2O2,O4)cobalt |
| Synonyms | Source |
|---|---|
| acetylacetone cobalt(II) | ChemIDplus |
| bis(2,4-dioxopentan-3-ido)cobalt | ChEBI |
| bis(2,4-pentanedionato)cobalt | ChemIDplus |
| bis(2,4-pentanedionato)cobalt(II) | ChEBI |
| bis(2,4-pentanedionato-O,O')cobalt | ChemIDplus |
| bis(acetylacetonato)cobalt | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 21493774 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4157956 | Reaxys |
| CAS:14024-48-7 | ChemIDplus |
| CAS:14024-48-7 | NIST Chemistry WebBook |
| Citations |
|---|