EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30O18 |
| Net Charge | 0 |
| Average Mass | 654.530 |
| Monoisotopic Mass | 654.14321 |
| SMILES | COc1c(O)cc2c(=O)oc3c(OC)c(OC4OC(CO)C(OC5OC(CO)C(O)C(O)C5O)C(O)C4O)cc4c(=O)oc1c2c34 |
| InChI | InChI=1S/C28H30O18/c1-39-20-9(31)3-7-13-14-8(26(38)44-23(13)20)4-10(22(40-2)24(14)45-25(7)37)41-27-19(36)17(34)21(12(6-30)43-27)46-28-18(35)16(33)15(32)11(5-29)42-28/h3-4,11-12,15-19,21,27-36H,5-6H2,1-2H3 |
| InChIKey | NPSMQMOQUDNLHU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methylellagic acid 2-(4-galactosylglucoside) (CHEBI:172786) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-[3,4-dihydroxy-6-(hydroxymethyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-13-hydroxy-7,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041397 | HMDB |