EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H34N2O7 |
| Net Charge | 0 |
| Average Mass | 618.686 |
| Monoisotopic Mass | 618.23660 |
| SMILES | COc1ccc2c(c1OC)C(CC1(C)C=Cc3c(c4cccc(OC)c4n(C)c3=O)O1)N(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C37H34N2O7/c1-37(15-14-24-34(46-37)23-8-7-9-27(41-4)33(23)39(3)36(24)40)18-26-31-21(12-13-28(42-5)35(31)43-6)22-11-10-20-16-29-30(45-19-44-29)17-25(20)32(22)38(26)2/h7-17,26H,18-19H2,1-6H3 |
| InChIKey | NUVWARFQHKLGOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simulanoquinoline (CHEBI:172774) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 2-[(1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)methyl]-7-methoxy-2,6-dimethylpyrano[3,2-c]quinolin-5-one |
| Manual Xrefs | Databases |
|---|---|
| 4479100 | ChemSpider |
| HMDB0040379 | HMDB |