EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H60O7 |
| Net Charge | 0 |
| Average Mass | 604.869 |
| Monoisotopic Mass | 604.43390 |
| SMILES | [H][C@]1([C@H](C)CCC=C(C)C)[C@H](O)C[C@@]2(C)C3C(OC)C=C4C(C)(C)C(O[C@@H]5OC[C@@H](O)[C@H](O)[C@H]5O)CC[C@]4([H])[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C36H60O7/c1-20(2)11-10-12-21(3)28-24(37)18-36(8)31-26(41-9)17-23-22(34(31,6)15-16-35(28,36)7)13-14-27(33(23,4)5)43-32-30(40)29(39)25(38)19-42-32/h11,17,21-22,24-32,37-40H,10,12-16,18-19H2,1-9H3/t21-,22+,24-,25-,26?,27?,28+,29+,30-,31?,32+,34-,35-,36+/m1/s1 |
| InChIKey | AKDNVAKNWZMAKY-ILFBRDFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hebevinoside IV (CHEBI:172771) is a cucurbitacin (CHEBI:16219) |
| Hebevinoside IV (CHEBI:172771) is a glycoside (CHEBI:24400) |
| IUPAC Name |
|---|
| (2S,3R,4S,5R)-2-[[(7R,9R,10R,13R,14S,16R,17R)-16-hydroxy-7-methoxy-4,4,9,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
| Manual Xrefs | Databases |
|---|---|
| 157458 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:101365-06-4 | ChemIDplus |