EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N4O4 |
| Net Charge | 0 |
| Average Mass | 434.496 |
| Monoisotopic Mass | 434.19541 |
| SMILES | CC(n1cc(CC(N)C(=O)O)c2ccccc21)n1cc(CC(N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C24H26N4O4/c1-14(27-12-15(10-19(25)23(29)30)17-6-2-4-8-21(17)27)28-13-16(11-20(26)24(31)32)18-7-3-5-9-22(18)28/h2-9,12-14,19-20H,10-11,25-26H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | DETVQFQGSVEQBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1'-Ethylidenebistryptophan (CHEBI:172675) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-amino-3-[1-[1-[3-(2-amino-2-carboxyethyl)indol-1-yl]ethyl]indol-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 3128372 | ChemSpider |
| HMDB0034899 | HMDB |