EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O4 |
| Net Charge | 0 |
| Average Mass | 402.575 |
| Monoisotopic Mass | 402.27701 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)OC)[C@]1([H])C(=O)CC1CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C25H38O4/c1-15(5-8-22(28)29-4)18-6-7-19-23-20(10-12-25(18,19)3)24(2)11-9-17(26)13-16(24)14-21(23)27/h15-16,18-20,23H,5-14H2,1-4H3/t15-,16?,18-,19+,20+,23+,24+,25-/m1/s1 |
| InChIKey | UZRRNRRCPZZPNY-ZECRIGHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7b-Hydroxy-3-oxo-5b-cholanoic acid (CHEBI:172644) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| methyl (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000541 | HMDB |
| LMST04010162 | LIPID MAPS |
| 17215969 | ChemSpider |