EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O9 |
| Net Charge | 0 |
| Average Mass | 398.408 |
| Monoisotopic Mass | 398.15768 |
| SMILES | COC(=O)c1cc(CC=C(C)C)c(O)c(OC2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C19H26O9/c1-9(2)4-5-10-6-11(18(25)26-3)7-12(14(10)21)27-19-17(24)16(23)15(22)13(8-20)28-19/h4,6-7,13,15-17,19-24H,5,8H2,1-3H3 |
| InChIKey | OZKMIACEGRRXQA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 3,4-dihydroxy-5-prenylbenzoate 3-glucoside (CHEBI:172635) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| methyl 4-hydroxy-3-(3-methylbut-2-enyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040121 | HMDB |