EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12N2O6S.2Na |
| Net Charge | 0 |
| Average Mass | 430.349 |
| Monoisotopic Mass | 430.02115 |
| SMILES | Cc1ccc(/N=N/c2c([O-])c(C(=O)O)cc3ccccc23)c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H14N2O6S.2Na/c1-10-6-7-14(15(8-10)27(24,25)26)19-20-16-12-5-3-2-4-11(12)9-13(17(16)21)18(22)23;;/h2-9,21H,1H3,(H,22,23)(H,24,25,26);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | VPWFPZBFBFHIIL-LLIZZRELSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lithol Rubine (CHEBI:172619) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-methylbenzenesulonate |
| Manual Xrefs | Databases |
|---|---|
| 21172211 | ChemSpider |