EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H7N5O9 |
| Net Charge | 0 |
| Average Mass | 365.214 |
| Monoisotopic Mass | 365.02438 |
| SMILES | [H]C(=NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H7N5O9/c18-11-8(3-6(15(20)21)4-9(11)16(22)23)12(19)14-13-5-7-1-2-10(26-7)17(24)25/h1-5,18H,(H,14,19) |
| InChIKey | XXUXXCZCUGIGPP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nifursol (CHEBI:172596) is a carbohydrazide (CHEBI:35363) |
| nifursol (CHEBI:172596) is a dinitrophenol (CHEBI:39352) |
| nifursol (CHEBI:172596) is a nitrofuran antibiotic (CHEBI:87230) |
| IUPAC Name |
|---|
| 2-hydroxy-3,5-dinitro-N'-[(5-nitrofuran-2-yl)methylidene]benzohydrazide |
| INNs | Source |
|---|---|
| nifursol | WHO MedNet |
| nifursol | WHO MedNet |
| nifursol | WHO MedNet |
| nifursolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,5-dinitrosalicylic acid (5-nitrofurfurylidene)hydrazide | ChemIDplus |
| 3,5-dinitrosalicyl-(5-nitrofurfurylidene)hydrazide | ChEBI |
| BT06G06 | ChEBI |
| 2-hydroxy-3,5-dinitro-N'-((5-nitrofuran-2-yl)methylene)benzohydrazide | ChEBI |
| Brand Names | Source |
|---|---|
| Histomon | ChemIDplus |
| Sulfuride | ChemIDplus |
| Salfuride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05166 | KEGG DRUG |
| 7844794 | ChemSpider |
| HMDB0031764 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:16915-70-1 | ChemIDplus |
| Citations |
|---|