EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O6 |
| Net Charge | 0 |
| Average Mass | 364.438 |
| Monoisotopic Mass | 364.18859 |
| SMILES | O=C(O)CCCC/C=C\CC(=O)/C=C/C=C/C=C\[C@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H28O6/c21-17(11-6-2-1-3-9-15-19(23)24)12-7-4-5-8-13-18(22)14-10-16-20(25)26/h2,4-8,12-13,18,22H,1,3,9-11,14-16H2,(H,23,24)(H,25,26)/b5-4+,6-2-,12-7+,13-8-/t18-/m0/s1 |
| InChIKey | VLMCDTMNMDDMLC-NZXMSVEXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-Oxo-20-carboxy-leukotriene B4 (CHEBI:172594) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (5R,6Z,8E,10E,14Z)-5-hydroxy-12-oxoicosa-6,8,10,14-tetraenedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 30776624 | ChemSpider |
| HMDB0012550 | HMDB |
| LMFA03020047 | LIPID MAPS |