EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O7 |
| Net Charge | 0 |
| Average Mass | 364.394 |
| Monoisotopic Mass | 364.15220 |
| SMILES | C=C1CC23CC1C(O)CC2C12OC(=O)C(C)(C(O)CC1O)C2C3C(=O)O |
| InChI | InChI=1S/C19H24O7/c1-7-5-18-6-8(7)9(20)3-10(18)19-12(22)4-11(21)17(2,16(25)26-19)14(19)13(18)15(23)24/h8-14,20-22H,1,3-6H2,2H3,(H,23,24) |
| InChIKey | QNHFLCWFHADENI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibberellin A55 (CHEBI:172593) is a C19-gibberellin (CHEBI:20858) |
| Gibberellin A55 (CHEBI:172593) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| IUPAC Name |
|---|
| 4,12,14-trihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013605 | ChemSpider |
| HMDB0033420 | HMDB |