EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O3 |
| Net Charge | 0 |
| Average Mass | 358.522 |
| Monoisotopic Mass | 358.25079 |
| SMILES | [H][C@@]1([C@@H](C)CC=O)CC[C@]2([H])/C(=C/C=C3\C[C@@H](O)C[C@@H](O)C3=C)CCC[C@@]12C |
| InChI | InChI=1S/C23H34O3/c1-15(10-12-24)20-8-9-21-17(5-4-11-23(20,21)3)6-7-18-13-19(25)14-22(26)16(18)2/h6-7,12,15,19-22,25-26H,2,4-5,8-11,13-14H2,1,3H3/b17-6+,18-7+/t15-,19+,20-,21+,22+,23-/m0/s1 |
| InChIKey | AOVGFTJYESGAEA-ZSCXDZJGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24,25,26,27-Tetranor-23-oxo-hydroxyvitamin D3 (CHEBI:172588) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (3S)-3-[(1S,3aR,4E,7aS)-4-[(2E)-2-[(3R,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal |
| Manual Xrefs | Databases |
|---|---|
| 30778535 | ChemSpider |
| HMDB0060114 | HMDB |